CAS 1265908-23-3
:(4S)-2-(3-Chloro-4-hydroxyphenyl)-4-thiazolidinecarboxylic acid
Description:
(4S)-2-(3-Chloro-4-hydroxyphenyl)-4-thiazolidinecarboxylic acid is a chemical compound characterized by its thiazolidine ring structure, which incorporates a sulfur atom and a carboxylic acid functional group. The presence of a chloro substituent and a hydroxy group on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit chirality due to the presence of a stereocenter, which can influence its pharmacological properties and interactions with biological targets. The thiazolidine framework is often associated with various therapeutic applications, particularly in the field of medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in drug development and synthesis. Overall, (4S)-2-(3-Chloro-4-hydroxyphenyl)-4-thiazolidinecarboxylic acid represents a complex structure with potential implications in pharmaceutical applications.
Formula:C10H10ClNO3S
InChI:InChI=1S/C10H10ClNO3S/c11-6-3-5(1-2-8(6)13)9-12-7(4-16-9)10(14)15/h1-3,7,9,12-13H,4H2,(H,14,15)/t7-,9?/m1/s1
InChI key:InChIKey=CJAPWNWFLYPMDO-YOXFSPIKSA-N
SMILES:C(O)(=O)[C@@H]1NC(SC1)C2=CC(Cl)=C(O)C=C2
Synonyms:- 4-Thiazolidinecarboxylic acid, 2-(3-chloro-4-hydroxyphenyl)-, (4S)-
- (4S)-2-(3-Chloro-4-hydroxyphenyl)-4-thiazolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.