CAS 126598-18-3
:7H-1,2,4-Triazolo(3,4-b)(1,3,4)thiadiazine-7-acetic acid, 3-(3,5-dimet hoxyphenyl-4-ethoxyphenyl)-6-(4-fluorophenyl)-
Description:
7H-1,2,4-Triazolo(3,4-b)(1,3,4)thiadiazine-7-acetic acid, with the CAS number 126598-18-3, is a complex organic compound characterized by its unique heterocyclic structure, which incorporates both triazole and thiadiazine rings. This compound features multiple functional groups, including an acetic acid moiety and various aromatic substituents, such as dimethoxyphenyl and ethoxyphenyl groups, along with a fluorophenyl group. These structural elements contribute to its potential biological activity and pharmacological properties. The presence of fluorine and methoxy groups may enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the compound's heterocyclic nature suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be further explored through various analytical methods, including spectroscopy and chromatography, to assess purity and structural integrity. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C22H21FN4O5S
InChI:InChI=1/C22H21FN4O5S/c1-4-32-20-15(30-2)9-13(10-16(20)31-3)21-24-25-22-27(21)26-19(17(33-22)11-18(28)29)12-5-7-14(23)8-6-12/h5-10,17H,4,11H2,1-3H3,(H,28,29)
SMILES:CCOc1c(cc(cc1OC)c1nnc2n1N=C(c1ccc(cc1)F)C(CC(=O)O)S2)OC
Synonyms:- 7H-1,2,4-Triazolo(3,4-b)(1,3,4)thiadiazine-7-acetic acid, 3-(3,5-dimethoxyphenyl-4-ethoxyphenyl)-6-(4-fluorophenyl)-
- [3-(4-ethoxy-3,5-dimethoxyphenyl)-6-(4-fluorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7H-1,2,4-Triazolo[3,4-b][1,3,4]thiadiazine-7-acetic acid, 3-(4-ethoxy-3,5-dimethoxyphenyl)-6-(4-fluorophenyl)-
CAS:Formula:C22H21FN4O5SMolecular weight:472.4893
