CymitQuimica logo

CAS 1266084-49-4

:

2,1-Benzoxaborol-6-amine, 1,3-dihydro-1-hydroxy-3,3-dimethyl-, hydrochloride (1:1)

Description:
2,1-Benzoxaborol-6-amine, 1,3-dihydro-1-hydroxy-3,3-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure that includes a benzoxaborole moiety, which is known for its potential biological activity. The presence of the amine and hydroxyl functional groups contributes to its reactivity and solubility in polar solvents. This compound is typically encountered as a hydrochloride salt, enhancing its stability and solubility in aqueous environments. The dimethyl substitution on the carbon framework may influence its steric properties and biological interactions. Benzoxaboroles are recognized for their applications in medicinal chemistry, particularly in the development of antifungal agents and other therapeutic compounds. The specific characteristics of this compound, including its melting point, solubility, and spectral properties, would be essential for understanding its behavior in various chemical contexts. Overall, this compound represents a class of substances with significant potential for pharmaceutical applications, warranting further investigation into its biological activity and mechanisms of action.
Formula:C9H12BNO2·ClH
InChI:InChI=1S/C9H12BNO2.ClH/c1-9(2)7-4-3-6(11)5-8(7)10(12)13-9;/h3-5,12H,11H2,1-2H3;1H
InChI key:InChIKey=BGIPFXQNSIIHMW-UHFFFAOYSA-N
SMILES:OB1C=2C(C(C)(C)O1)=CC=C(N)C2.Cl
Synonyms:
  • 2,1-Benzoxaborol-6-amine, 1,3-dihydro-1-hydroxy-3,3-dimethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.