CAS 1266111-71-0

L-Proline, 4-(4-acetylphenoxy)-, methyl ester, hydrochloride (1:1), (4S)-

Description:

L-Proline, 4-(4-acetylphenoxy)-, methyl ester, hydrochloride (1:1), (4S)- is a synthetic compound that combines the amino acid proline with an acetylphenoxy moiety and a methyl ester functional group. This compound is characterized by its chiral center, which contributes to its specific stereochemistry, denoted as (4S)-. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in polar solvents, making it suitable for various applications in biochemical and pharmaceutical research. The acetylphenoxy group may impart unique properties, such as increased lipophilicity or specific interactions with biological targets. As a derivative of proline, it may exhibit biological activity, potentially influencing protein structure or function. The compound's molecular structure suggests it could be involved in peptide synthesis or serve as a building block in drug development. Overall, its unique combination of functional groups and stereochemistry makes it a compound of interest in medicinal chemistry and related fields.

Formula: C₁₄H₁₇NO₄·ClH

InChI: InChI=1S/C14H17NO4.ClH/c1-9(16)10-3-5-11(6-4-10)19-12-7-13(15-8-12)14(17)18-2;/h3-6,12-13,15H,7-8H2,1-2H3;1H/t12-,13-;/m0./s1

InChI key: InChIKey=FEAIEBOFKWWORY-QNTKWALQSA-N

SMILES: O([C@H]1C[C@@H](C(OC)=O)NC1)C2=CC=C(C(C)=O)C=C2.Cl

Synonyms:

• L-Proline, 4-(4-acetylphenoxy)-, methyl ester, hydrochloride (1:1), (4S)-