CAS 1266114-63-9
:Ethyl 3H-imidazo[4,5-c]pyridine-7-carboxylate
Description:
Ethyl 3H-imidazo[4,5-c]pyridine-7-carboxylate is a heterocyclic organic compound characterized by its imidazo and pyridine ring structures. This compound features a carboxylate ester functional group, which contributes to its reactivity and solubility properties. Typically, it appears as a solid or liquid depending on the specific conditions, and it may exhibit moderate to high polarity due to the presence of the carboxylate group. Ethyl 3H-imidazo[4,5-c]pyridine-7-carboxylate is of interest in medicinal chemistry, particularly for its potential biological activities, including antimicrobial and anticancer properties. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during its use in laboratory or industrial settings.
Formula:C9H9N3O2
InChI:InChI=1S/C9H9N3O2/c1-2-14-9(13)6-3-10-4-7-8(6)12-5-11-7/h3-5H,2H2,1H3,(H,11,12)
InChI key:InChIKey=VYYJINSKLFNOGW-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2C(=CN=C1)N=CN2
Synonyms:- 3H-Imidazo[4,5-c]pyridine-7-carboxylic acid, ethyl ester
- Ethyl 3H-imidazo[4,5-c]pyridine-7-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
ethyl 3H-imidazo[4,5-c]pyridine-7-carboxylate
CAS:Formula:C9H9N3O2Color and Shape:SolidMolecular weight:191.1867Ethyl 3H-imidazo[4,5-c]pyridine-7-carboxylate
CAS:Ethyl 3H-imidazo[4,5-c]pyridine-7-carboxylate
Molecular weight:191.18666g/mol


