CAS 1266114-64-0
:2-(Chloromethyl)-1,3-difluoro-5-methylbenzene
Description:
2-(Chloromethyl)-1,3-difluoro-5-methylbenzene, also known by its CAS number 1266114-64-0, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chloromethyl group, two fluorine atoms, and a methyl group. The presence of the chloromethyl group indicates that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The difluoro substituents contribute to its reactivity and influence its physical properties, such as boiling and melting points, as well as its solubility in various solvents. The methyl group adds to the compound's hydrophobic character. This compound may exhibit unique electronic properties due to the electron-withdrawing effects of the fluorine atoms, which can affect its reactivity and interactions with other chemical species. Overall, 2-(Chloromethyl)-1,3-difluoro-5-methylbenzene is of interest in the fields of medicinal chemistry and materials science for its potential applications in the synthesis of more complex molecules.
Formula:C8H7ClF2
InChI:InChI=1S/C8H7ClF2/c1-5-2-7(10)6(4-9)8(11)3-5/h2-3H,4H2,1H3
InChI key:InChIKey=CXUSOAHUFFVMAL-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(F)C=C(C)C=C1F
Synonyms:- 2-(Chloromethyl)-1,3-difluoro-5-methylbenzene
- Benzene, 2-(chloromethyl)-1,3-difluoro-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.