CymitQuimica logo

CAS 1266119-38-3

:

6-Methoxy-2-methylquinazoline

Description:
6-Methoxy-2-methylquinazoline is a heterocyclic organic compound characterized by its quinazoline backbone, which consists of a fused benzene and pyrimidine ring. The presence of a methoxy group at the 6-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic nature. It is often studied for its potential biological activities, including antimicrobial and anticancer properties, owing to the structural features common in many bioactive compounds. The methoxy group can influence the compound's reactivity and interaction with biological targets. Additionally, 6-Methoxy-2-methylquinazoline may undergo various chemical reactions, such as alkylation or oxidation, depending on the reaction conditions. Its molecular structure allows for potential modifications that can enhance its pharmacological profile, making it of interest in medicinal chemistry and drug development.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-7-11-6-8-5-9(13-2)3-4-10(8)12-7/h3-6H,1-2H3
InChI key:InChIKey=FOONPDRKBRIVHM-UHFFFAOYSA-N
SMILES:O(C)C1=CC2=C(N=C(C)N=C2)C=C1
Synonyms:
  • Quinazoline, 6-methoxy-2-methyl-
  • 6-Methoxy-2-methylquinazoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.