CAS 126612-52-0
:N-(5-fluorobenzothiazol-2-yl)-2-guanidinothiazole-4-carboxamide
Description:
N-(5-fluorobenzothiazol-2-yl)-2-guanidinothiazole-4-carboxamide, with the CAS number 126612-52-0, is a chemical compound characterized by its complex structure, which includes a benzothiazole moiety and a guanidinothiazole group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the fluorine atom in the benzothiazole ring can enhance lipophilicity and influence the compound's interaction with biological targets. The guanidine functional group is known for its ability to form hydrogen bonds, which may contribute to the compound's pharmacological properties. Additionally, the thiazole rings in the structure can participate in various chemical reactions, making this compound a versatile candidate for further chemical modifications. Overall, this substance is primarily studied for its potential applications in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C12H9FN6OS2
InChI:InChI=1/C12H9FN6OS2/c13-5-1-2-8-6(3-5)16-12(22-8)18-9(20)7-4-21-11(17-7)19-10(14)15/h1-4H,(H,16,18,20)(H4,14,15,17,19)
SMILES:c1cc2c(cc1F)nc(N=C(c1csc(n1)NC(=N)N)O)s2
Synonyms:- 2-((Aminoiminomethyl)amino)-N-(5-fluoro-2-benzothiazolyl)-4-thiazolecarboxamide
- 5-Fbgt
- 4-Thiazolecarboxamide, 2-((aminoiminomethyl)amino)-N-(5-fluoro-2-benzothiazolyl)-
- 2-[(diaminomethylidene)amino]-N-(5-fluoro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide
- N-(5-Fluorobenzothiazol-2-yl)-2-guanidinothiazole-4-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Thiazolecarboxamide, 2-[(aminoiminomethyl)amino]-N-(5-fluoro-2-benzothiazolyl)-
CAS:Formula:C12H9FN6OS2Molecular weight:336.3679
