CymitQuimica logo

CAS 126613-08-9

:

1-Bromo-2-naphthyl triflate

Description:
1-Bromo-2-naphthyl triflate, with the CAS number 126613-08-9, is an organic compound characterized by the presence of a bromine atom and a triflate group attached to a naphthalene ring system. This compound features a naphthyl moiety, which consists of two fused benzene rings, providing it with significant aromatic character and stability. The triflate group, derived from trifluoromethanesulfonic acid, is a highly reactive leaving group, making this compound useful in various synthetic applications, particularly in nucleophilic substitution reactions. The presence of the bromine atom enhances its reactivity, allowing for further functionalization. 1-Bromo-2-naphthyl triflate is typically used in organic synthesis, especially in the preparation of more complex molecules, and can serve as a precursor for various transformations in medicinal chemistry and materials science. Its properties, such as solubility and reactivity, are influenced by the electronic effects of the bromine and triflate groups, making it a valuable compound in the field of synthetic organic chemistry.
Formula:C11H6BrF3O3S
InChI:InChI=1S/C11H6BrF3O3S/c12-10-8-4-2-1-3-7(8)5-6-9(10)18-19(16,17)11(13,14)15/h1-6H
InChI key:InChIKey=COHWGJMHCMOXLL-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=CC1OS(C(F)(F)F)(=O)=O)C=CC=C2
Synonyms:
  • Methanesulfonic acid, trifluoro-, 1-bromo-2-naphthalenyl ester
  • Methanesulfonic acid, 1,1,1-trifluoro-, 1-bromo-2-naphthalenyl ester
  • 1-Bromo-2-naphthalenyl trifluoromethanesulfonate
  • 1-Bromo-2-naphthyl triflate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.