CAS 126617-98-9
:[2-(Methoxymethyl)phenyl]-boronic acid
Description:
[2-(Methoxymethyl)phenyl]-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a methoxymethyl substituent. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The methoxymethyl group enhances its solubility in organic solvents and may influence its reactivity and stability. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in the synthesis of complex organic molecules. The compound's structure allows for potential interactions with biological targets, making it of interest in drug development. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Overall, [2-(Methoxymethyl)phenyl]-boronic acid is a versatile compound with significant utility in both synthetic and biological chemistry.
Formula:C8H11BO3
InChI:InChI=1/C8H11BO3/c1-12-6-7-4-2-3-5-8(7)9(10)11/h2-5,10-11H,6H2,1H3
SMILES:COCc1ccccc1B(O)O
Synonyms:- 2-Methoxymethylphenylboronicacid
- 2-Methoxymethylphenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Methoxymethyl)benzeneboronic acid, 97%
CAS:2-(Methoxymethyl)benzeneboronic acid used as a intermediate for pharmaceutical. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item codeFormula:C8H11BO3Purity:97%Molecular weight:165.98(2-(Methoxymethyl)phenyl)boronic acid
CAS:Formula:C8H11BO3Purity:97%Color and Shape:SolidMolecular weight:165.98212-(Methoxymethyl)benzeneboronic acid
CAS:2-(Methoxymethyl)benzeneboronic acidFormula:C8H11BO3Purity:97%Color and Shape: white solidMolecular weight:165.98g/mol2-Methoxymethylbenzeneboronic acid
CAS:Formula:C8H11BO3Purity:98%Color and Shape:SolidMolecular weight:165.98



