CAS 1266227-15-9

N-(5-Bromo-3-pyridinyl)butanamide

Description:

N-(5-Bromo-3-pyridinyl)butanamide is a chemical compound characterized by its structural features, which include a butanamide moiety linked to a pyridine ring that is substituted with a bromine atom at the 5-position. This compound typically exhibits properties associated with both amides and heterocyclic aromatic compounds. The presence of the bromine atom can influence its reactivity, solubility, and biological activity, making it of interest in medicinal chemistry and drug development. The pyridine ring contributes to the compound's aromaticity and potential interactions with biological targets. Additionally, the butanamide group may enhance its lipophilicity and influence its pharmacokinetic properties. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility in various solvents would depend on the specific conditions and purity of the sample. Overall, N-(5-Bromo-3-pyridinyl)butanamide is a compound that may have applications in research, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₉H₁₁BrN₂O

InChI: InChI=1S/C9H11BrN2O/c1-2-3-9(13)12-8-4-7(10)5-11-6-8/h4-6H,2-3H2,1H3,(H,12,13)

InChI key: InChIKey=JPOXHFFVKGUQLD-UHFFFAOYSA-N

SMILES: N(C(CCC)=O)C=1C=C(Br)C=NC1

Synonyms:

• N-(5-Bromopyridin-3-yl)butyramide
• N-(5-Bromo-3-pyridinyl)butanamide
• Butanamide, N-(5-bromo-3-pyridinyl)-