CAS 126624-55-3
:Ethanone, 2-chloro-1-(1-methyl-1H-pyrrol-3-yl)- (9CI)
Description:
Ethanone, 2-chloro-1-(1-methyl-1H-pyrrol-3-yl)-, also known by its CAS number 126624-55-3, is an organic compound characterized by the presence of a chloro substituent and a pyrrole ring. This compound features a ketone functional group (ethanone) and is notable for its potential biological activity, which may include interactions with various biological targets. The presence of the chloro group typically enhances the compound's reactivity and can influence its solubility and stability. The pyrrole moiety contributes to the compound's aromatic character, which may affect its electronic properties and reactivity. In terms of physical properties, such compounds often exhibit moderate volatility and may be soluble in organic solvents. The specific applications and safety considerations of this compound would depend on its chemical behavior and interactions, making it relevant in fields such as medicinal chemistry and materials science. As with any chemical substance, proper handling and safety protocols should be observed due to potential toxicity or reactivity.
Formula:C7H8ClNO
InChI:InChI=1/C7H8ClNO/c1-9-3-2-6(5-9)7(10)4-8/h2-3,5H,4H2,1H3
SMILES:Cn1ccc(c1)C(=O)CCl
Synonyms:- 2-Chloro-1-(1-methyl-1H-pyrrol-3-yl)ethanone
- ethanone, 2-chloro-1-(1-methyl-1H-pyrrol-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
