CAS 126631-93-4
:8-(fmoc-amino)octanoic acid
Description:
8-(Fmoc-amino)octanoic acid is a synthetic amino acid derivative characterized by the presence of a fluorenylmethyloxycarbonyl (Fmoc) protective group attached to the amino group of octanoic acid. This compound features a long hydrophobic carbon chain, which contributes to its amphiphilic nature, making it useful in various biochemical applications, particularly in peptide synthesis and drug development. The Fmoc group serves as a protective moiety that can be removed under mild basic conditions, allowing for selective deprotection during peptide synthesis. The presence of the carboxylic acid functional group at one end of the molecule provides it with acidic properties, while the amino group at the other end allows for the formation of peptide bonds. This compound is often utilized in solid-phase peptide synthesis due to its ability to facilitate the assembly of peptides with specific sequences. Its unique structure and functional groups make it a valuable building block in the field of medicinal chemistry and biochemistry.
Formula:C22H24N2O4
InChI:InChI=1/C22H24N2O4/c25-21(26)13-24-11-9-15(10-12-24)23-22(27)28-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,15,20H,9-14H2,(H,23,27)(H,25,26)
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=NC1CCN(CC1)CC(=O)O)O
Synonyms:- Fmoc-8-Aoc-OH
- 8-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}octanoic acid
- (4-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}piperidin-1-yl)acetic acid
- N-Fmoc-8-Aminooctanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Fmoc-8-aminooctanoic acid
CAS:Aoc, a flexible hydrophobic spacer, can also be incorporated in a peptide chain as an equivalent of a tripeptide.Formula:C23H27NO4Purity:99.6%Color and Shape:White PowderMolecular weight:381.47Octanoic acid, 8-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
CAS:Formula:C23H27NO4Purity:97%Color and Shape:SolidMolecular weight:381.46488-Aminooctanoic acid, N-FMOC protected
CAS:8-Aminooctanoic acid, N-FMOC protectedPurity:98%Molecular weight:381.46g/molN-Fmoc-8-Aminooctanoic acid
CAS:Formula:C23H27NO4Purity:95%Color and Shape:SolidMolecular weight:381.472N-Fmoc-8-aminooctanoic acid
CAS:N-Fmoc-8-aminooctanoic acid: a PROTAC linker with deprotectable Fmoc-amine and reactive carboxylic end for stable amide bonds.Formula:C23H27NO4Color and Shape:SolidMolecular weight:381.46







