CAS 1266386-31-5
:4-Bromo-2-(tetrahydro-2H-pyran-2-yl)-2H-indazole
Description:
4-Bromo-2-(tetrahydro-2H-pyran-2-yl)-2H-indazole is a chemical compound characterized by its unique structural features, which include a bromine atom and a tetrahydro-pyran moiety attached to an indazole core. The presence of the bromine substituent typically enhances the compound's reactivity and can influence its biological activity. The tetrahydro-2H-pyran group contributes to the compound's overall stability and solubility in organic solvents. This compound is likely to exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its indazole framework is known for its potential applications in drug development, particularly in the fields of neuropharmacology and oncology. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, due to the presence of both electron-rich and electron-deficient sites. Overall, 4-Bromo-2-(tetrahydro-2H-pyran-2-yl)-2H-indazole represents a versatile scaffold for further chemical modifications and investigations into its biological activities.
Formula:C12H13BrN2O
InChI:InChI=1S/C12H13BrN2O/c13-10-4-3-5-11-9(10)8-15(14-11)12-6-1-2-7-16-12/h3-5,8,12H,1-2,6-7H2
InChI key:InChIKey=JJJWAPQDJLALQV-UHFFFAOYSA-N
SMILES:BrC=1C2=CN(N=C2C=CC1)C3CCCCO3
Synonyms:- 4-Bromo-2-(tetrahydro-2H-pyran-2-yl)-2H-indazole
- 2H-Indazole, 4-bromo-2-(tetrahydro-2H-pyran-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
