CAS 126645-52-1

4-Benzylmorpholine-2-carbonitrile

Description:

4-Benzylmorpholine-2-carbonitrile is a chemical compound characterized by its morpholine structure, which includes a benzyl group and a cyano group attached to the morpholine ring. This compound typically exhibits properties associated with both the morpholine and nitrile functional groups, such as moderate polarity and potential solubility in organic solvents. The presence of the benzyl group can enhance its lipophilicity, making it more soluble in non-polar solvents. It may also exhibit biological activity, as many morpholine derivatives are known for their pharmacological properties. The cyano group can participate in various chemical reactions, including nucleophilic additions and cycloadditions, making this compound potentially useful in synthetic organic chemistry. Additionally, 4-Benzylmorpholine-2-carbonitrile may serve as an intermediate in the synthesis of more complex molecules or as a building block in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₂H₁₄N₂O

InChI: InChI=1/C12H14N2O/c13-8-12-10-14(6-7-15-12)9-11-4-2-1-3-5-11/h1-5,12H,6-7,9-10H2

SMILES: c1ccc(cc1)CN1CCOC(C#N)C1

Synonyms:

• 2-Morpholinecarbonitrile, 4-(phenylmethyl)-

2-Morpholinecarbonitrile, 4-(phenylmethyl)-

CAS: 126645-52-1

Formula: C₁₂H₁₄N₂O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 202.2524

Ref: IN-DA000T2D

4-Benzylmorpholine-2-carbonitrile

CAS: 126645-52-1

4-Benzylmorpholine-2-carbonitrile

Purity: 99%

Molecular weight: 202.25g/mol

Ref: 54-OR301246

4-Benzylmorpholine-2-carbonitrile

CAS: 126645-52-1

Formula: C₁₂H₁₄N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 202.257

Ref: 10-F068953

4-Benzylmorpholine-2-carbonitrile

Controlled Product

CAS: 126645-52-1

Applications 4-benzylmorpholine-2-carbonitrile (cas# 126645-52-1) is a useful research chemical.

Formula: C₁₂H₁₄N₂O

Color and Shape: Neat

Molecular weight: 202.25

Ref: TR-B535160