CAS 126646-15-9
:3,6,9,12,15,18,21,24,27-Nonaoxapentatriacontanoic acid, sodium salt (1:1)
Description:
3,6,9,12,15,18,21,24,27-Nonaoxapentatriacontanoic acid, sodium salt (1:1), is a synthetic compound characterized by its long-chain structure comprising multiple ether linkages. This compound features a polyether backbone, which contributes to its unique properties, such as increased solubility in polar solvents and potential surfactant behavior. The presence of the sodium salt form indicates that it is likely to be more soluble in aqueous environments, making it useful in various applications, including as an emulsifier or stabilizer in formulations. The compound's long carbon chain may also impart hydrophobic characteristics, while the ether groups enhance its compatibility with both hydrophilic and hydrophobic substances. Its molecular structure suggests potential applications in fields such as pharmaceuticals, cosmetics, and materials science, where surfactant properties and solubility are critical. Additionally, the compound's stability and reactivity can be influenced by environmental factors, making it important to consider its behavior in different conditions during practical applications.
Formula:C26H52O11·Na
InChI:InChI=1S/C26H52O11.Na/c1-2-3-4-5-6-7-8-29-9-10-30-11-12-31-13-14-32-15-16-33-17-18-34-19-20-35-21-22-36-23-24-37-25-26(27)28;/h2-25H2,1H3,(H,27,28);
InChI key:InChIKey=SMAZPMQWHCRWEM-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCOCCCCCCCC)CCOCCOCCOCC(O)=O.[Na]
Synonyms:- Natrium-Polyoxyethylen-caprylethercarboxylat, (C8)
- 3,6,9,12,15,18,21,24,27-Nonaoxapentatriacontanoic acid, sodium salt
- 3,6,9,12,15,18,21,24,27-Nonaoxapentatriacontanoic acid, sodium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
