
CAS 126646-16-0
:3,6,9,12-Tetraoxaoctadecanoic acid, sodium salt (1:1)
Description:
3,6,9,12-Tetraoxaoctadecanoic acid, sodium salt (1:1), with CAS number 126646-16-0, is a synthetic compound characterized by its long-chain fatty acid structure that incorporates multiple ether linkages. This compound features a hydrophilic head due to the presence of sodium salt, which enhances its solubility in water compared to traditional fatty acids. The tetraoxaoctadecanoic acid structure suggests that it has four ether functional groups, contributing to its unique properties such as increased stability and potential applications in surfactants or emulsifiers. The sodium salt form indicates that it can dissociate in solution, making it useful in various formulations, including pharmaceuticals and cosmetics. Its molecular structure allows for interactions with both hydrophilic and hydrophobic environments, making it versatile in applications that require surfactant properties. Overall, this compound is notable for its potential in enhancing solubility and stability in various chemical formulations.
Formula:C14H28O6·Na
InChI:InChI=1S/C14H28O6.Na/c1-2-3-4-5-6-17-7-8-18-9-10-19-11-12-20-13-14(15)16;/h2-13H2,1H3,(H,15,16);
InChI key:InChIKey=LWWZIHVCMGJMSK-UHFFFAOYSA-N
SMILES:C(COCCOCCCCCC)OCCOCC(O)=O.[Na]
Synonyms:- 3,6,9,12-Tetraoxaoctadecanoic acid, sodium salt
- 3,6,9,12-Tetraoxaoctadecanoic acid, sodium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
