CAS 1266522-92-2
:4-Piperidinecarboxylic acid, 3-oxo-, methyl ester, hydrochloride (1:1)
Description:
4-Piperidinecarboxylic acid, 3-oxo-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basic properties. This compound features a carboxylic acid functional group and a methyl ester, indicating it can participate in various chemical reactions, such as esterification and hydrolysis. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications in pharmaceuticals and organic synthesis. The compound is likely to exhibit moderate to high polarity due to the functional groups present, which can influence its interaction with biological systems. Additionally, the 3-oxo group suggests potential reactivity, allowing for further derivatization. Overall, this compound's unique structure and functional groups make it a valuable intermediate in the synthesis of more complex molecules, particularly in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity and reactivity.
Formula:C7H11NO3·ClH
InChI:InChI=1S/C7H11NO3.ClH/c1-11-7(10)5-2-3-8-4-6(5)9;/h5,8H,2-4H2,1H3;1H
InChI key:InChIKey=AMWWTJSYWYVERE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C(=O)CNCC1.Cl
Synonyms:- 4-Piperidinecarboxylic acid, 3-oxo-, methyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
