
CAS 126654-63-5
:Thiazolo[3,2-a]indole-9-carboxaldehyde, 2,3-dihydro-3-hydroxy-3-methyl-
Description:
Thiazolo[3,2-a]indole-9-carboxaldehyde, 2,3-dihydro-3-hydroxy-3-methyl- is a heterocyclic compound characterized by its unique structural features, which include a thiazole ring fused to an indole system. This compound typically exhibits a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a hydroxyl group and a methyl group on the dihydro portion of the molecule enhances its solubility and may influence its biological activity. Thiazoloindoles are known for their diverse pharmacological properties, including antimicrobial and anticancer activities, making this compound of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C12H11NO2S
InChI:InChI=1S/C12H11NO2S/c1-12(15)7-16-11-9(6-14)8-4-2-3-5-10(8)13(11)12/h2-6,15H,7H2,1H3
InChI key:InChIKey=ZIEFIDANMCIAOW-UHFFFAOYSA-N
SMILES:C(=O)C1=C2N(C=3C1=CC=CC3)C(C)(O)CS2
Synonyms:- Brassicanal B
- Thiazolo[3,2-a]indole-9-carboxaldehyde, 2,3-dihydro-3-hydroxy-3-methyl-
- 3-Hydroxy-3-methyl-2H,3H-[1,3]thiazolo[3,2-a]indole-9-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thiazolo[3,2-a]indole-9-carboxaldehyde, 2,3-dihydro-3-hydroxy-3-methyl- (9CI)
CAS:Formula:C12H11NO2SMolecular weight:233.2862
