CymitQuimica logo

CAS 126657-30-5

:

3,5-Dimethyl-3',5'-ditert-butyldiphenoquinone

Description:
3,5-Dimethyl-3',5'-ditert-butyldiphenoquinone is a synthetic organic compound characterized by its unique structure, which includes two tert-butyl groups and two methyl groups attached to a diphenoquinone framework. This compound is known for its stability and potential applications in organic synthesis and materials science. The presence of the tert-butyl groups enhances its solubility in organic solvents and contributes to its steric hindrance, which can influence its reactivity and interactions with other molecules. Additionally, the quinone functional groups impart redox properties, making it useful in various chemical reactions, including electron transfer processes. The compound may exhibit interesting optical properties due to its conjugated system, which can be explored in photochemical applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 3,5-Dimethyl-3',5'-ditert-butyldiphenoquinone represents a versatile compound in the field of organic chemistry.
Formula:C22H28O2
InChI:InChI=1/C22H28O2/c1-13-9-15(10-14(2)19(13)23)16-11-17(21(3,4)5)20(24)18(12-16)22(6,7)8/h9-12H,1-8H3
SMILES:CC1=CC(=C2C=C(C(=O)C(=C2)C(C)(C)C)C(C)(C)C)C=C(C)C1=O
Synonyms:
  • 2,6-bis(1,1-dimethylethyl)-4-(3,5-dimethyl-4-oxo-2,5-cyclohexadien-1-ylidene)-2,5-Cyclohexadien-1-one
  • 3,5-Dimethyl-3',5'-Di-T-Butyl-4,4'-Diphenoquinone
  • 3,5-Di-Tert-Butyl-3',5'-Dimethyl-1,1'-Bi(Cyclohexa-2,5-Dien-1-Ylidene)-4,4'-Dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.