
CAS 126661-83-4
:(+)-Cyclophellitol
Description:
(+)-Cyclophellitol is a naturally occurring compound classified as a sugar alcohol, specifically a cyclitol. It is characterized by its unique bicyclic structure, which features a cyclopentane ring fused to a cyclohexane ring, contributing to its distinctive chemical properties. This compound is known for its ability to inhibit certain enzymes, particularly glycosidases, making it of interest in biochemical research and potential therapeutic applications. (+)-Cyclophellitol is typically obtained from natural sources, such as specific fungi, and exhibits solubility in polar solvents due to its hydroxyl functional groups. Its stereochemistry is significant, as the specific configuration of its chiral centers influences its biological activity and interactions with other molecules. Additionally, (+)-Cyclophellitol has been studied for its potential role in modulating metabolic pathways, which may have implications in the development of treatments for various diseases, including diabetes. Overall, its unique structural and functional characteristics make it a valuable compound in both natural product chemistry and pharmacology.
Formula:C7H12O5
InChI:InChI=1S/C7H12O5/c8-1-2-3(9)4(10)5(11)7-6(2)12-7/h2-11H,1H2/t2-,3-,4+,5-,6-,7+/m1/s1
InChI key:InChIKey=YQLWKYQDOQEWRD-GEGSFZHJSA-N
SMILES:C(O)[C@H]1[C@@]2([C@@](O2)([C@H](O)[C@@H](O)[C@@H]1O)[H])[H]
Synonyms:- (+)-Cyclophellitol
- 7-Oxabicyclo[4.1.0]heptane, D-myo-inositol deriv.
- 1,2-Anhydro-3-deoxy-3-(hydroxymethyl)-D-myo-inositol
- Cyclophellitol
- D-myo-Inositol, 1,2-anhydro-3-deoxy-3-(hydroxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cyclophellitol
CAS:Cyclophellitol is an inhibitor of β-glycosidase, with an IC50 of 0.8 μg/mL.Formula:C7H12O5Color and Shape:SolidMolecular weight:176.167

