CAS 126663-38-5
:N-hydroxythalidomide
Description:
N-hydroxythalidomide is a derivative of thalidomide, a compound originally developed as a sedative and later recognized for its teratogenic effects. This substance is characterized by the presence of a hydroxylamine functional group, which contributes to its unique chemical properties and biological activities. N-hydroxythalidomide is known for its potential therapeutic applications, particularly in the treatment of certain cancers and inflammatory conditions, as it exhibits immunomodulatory effects. The compound is typically a white to off-white solid and is soluble in organic solvents. Its molecular structure allows for interactions with various biological targets, influencing pathways related to angiogenesis and immune response. Due to its structural modifications compared to thalidomide, N-hydroxythalidomide aims to retain beneficial effects while minimizing adverse outcomes associated with its predecessor. As research continues, understanding its pharmacokinetics and mechanisms of action remains crucial for developing safe and effective therapeutic strategies.
Formula:C13H10N2O5
InChI:InChI=1/C13H10N2O5/c16-10-6-5-9(13(19)15(10)20)14-11(17)7-3-1-2-4-8(7)12(14)18/h1-4,9,20H,5-6H2
Synonyms:- 2-(1-hydroxy-2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione
- N-Hydroxythalidomide
- 1H-Isoindole-1,3(2H)-dione, 2-(1-hydroxy-2,6-dioxo-3-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
