CAS 126664-28-6
:4-(2-methyl-4-nitro-1H-imidazol-1-yl)butan-2-one
Description:
4-(2-methyl-4-nitro-1H-imidazol-1-yl)butan-2-one, with the CAS number 126664-28-6, is a chemical compound characterized by its imidazole ring, which contributes to its biological activity and potential applications in pharmaceuticals. This compound features a butan-2-one moiety, indicating the presence of a ketone functional group, which can influence its reactivity and solubility. The nitro group attached to the imidazole ring enhances its electron-withdrawing properties, potentially affecting its interaction with biological targets. The methyl group on the imidazole ring may also play a role in steric hindrance and overall molecular stability. This compound is likely to exhibit moderate to high polarity due to the presence of both polar functional groups and the imidazole structure, which can facilitate hydrogen bonding. Its unique structural features suggest potential applications in medicinal chemistry, particularly in the development of antimicrobial or anticancer agents, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity associated with nitro compounds.
Formula:C8H11N3O3
InChI:InChI=1/C8H11N3O3/c1-6(12)3-4-10-5-8(11(13)14)9-7(10)2/h5H,3-4H2,1-2H3
SMILES:CC(=O)CCn1cc(nc1C)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
