CAS 126671-80-5

(2R,3R,4aS)-2,3,7-trihydroxy-9-methoxy-4a-methyl-2,3,4,4a-tetrahydro-6H-benzo[c]chromen-6-one

Description:

The chemical substance known as (2R,3R,4aS)-2,3,7-trihydroxy-9-methoxy-4a-methyl-2,3,4,4a-tetrahydro-6H-benzo[c]chromen-6-one, with the CAS number 126671-80-5, is a complex organic compound characterized by its polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties, and a methoxy group that can influence its solubility and reactivity. The stereochemistry indicated by the (2R,3R,4aS) configuration suggests specific spatial arrangements of its atoms, which can significantly affect its biological activity and interactions with other molecules. The presence of a benzo[c]chromen moiety indicates that it may exhibit properties similar to flavonoids, including potential anti-inflammatory and neuroprotective effects. Its tetrahydro structure implies that it is a saturated derivative, which may enhance its stability compared to unsaturated analogs. Overall, this compound's unique structural features make it of interest in various fields, including medicinal chemistry and pharmacology, where it may be explored for therapeutic applications.

Formula: C₁₅H₁₆O₆

InChI: InChI=1/C15H16O6/c1-15-6-12(18)10(16)5-9(15)8-3-7(20-2)4-11(17)13(8)14(19)21-15/h3-5,10,12,16-18H,6H2,1-2H3/t10-,12-,15+/m1/s1

Isoaltenuene

CAS: 126671-80-5

Isoaltenuene: antibiotic against Gram-positive bacteria, slightly phytotoxic at 20 µg/spot, cytotoxic to A549, MDA-MB-231, PANC-1 cancer cells.

Formula: C₁₅H₁₆O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 292.287

Ref: TM-TN4261

Isoaltenuene

CAS: 126671-80-5

Isoaltenuene is a chemical compound that is an isomeric hydrocarbon derived from Cannabis sativa, which is a plant known for its diverse chemical profile, including cannabinoids and terpenes. The distinctive aromatic properties of Isoaltenuene are attributed to its unique molecular structure that sets it apart from other compounds found in the cannabis plant.

Formula: C₁₅H₁₆O₆

Purity: Min. 95%

Molecular weight: 292.28 g/mol

Ref: 3D-BFA67180