CymitQuimica logo

CAS 1266728-35-1

:

6-Bromo-8-quinolinemethanol

Description:
6-Bromo-8-quinolinemethanol is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a bromine substituent at the 6-position. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, making it a potential candidate for various chemical reactions and applications. The presence of the bromine atom can enhance its reactivity, allowing for further derivatization or participation in nucleophilic substitution reactions. Additionally, the hydroxyl group (-OH) contributes to its solubility in polar solvents and may influence its biological activity. Compounds of this nature are often studied for their potential pharmacological properties, including antimicrobial and anticancer activities. The specific interactions and stability of 6-Bromo-8-quinolinemethanol can be influenced by factors such as pH, solvent, and temperature. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Overall, this compound represents an interesting subject for further research in medicinal chemistry and related fields.
Formula:C10H8BrNO
InChI:InChI=1S/C10H8BrNO/c11-9-4-7-2-1-3-12-10(7)8(5-9)6-13/h1-5,13H,6H2
InChI key:InChIKey=HBQPJPSNCZMFRH-UHFFFAOYSA-N
SMILES:C(O)C=1C2=C(C=C(Br)C1)C=CC=N2
Synonyms:
  • 8-Quinolinemethanol, 6-bromo-
  • 6-Bromo-8-quinolinemethanol
  • (6-Bromoquinolin-8-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.