CAS 126674-78-0

2-Amino-3,5-difluorobenzoic acid

Description:

2-Amino-3,5-difluorobenzoic acid is an aromatic amino acid characterized by the presence of both amino and carboxylic acid functional groups, making it a member of the amino acid family. Its molecular structure features a benzene ring substituted with two fluorine atoms at the 3 and 5 positions, and an amino group at the 2 position. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid and amino groups. The difluorination introduces unique electronic properties, potentially influencing its reactivity and interactions in biological systems. It may exhibit acidic behavior due to the carboxylic acid group and can participate in hydrogen bonding due to the amino group. This compound is of interest in various fields, including pharmaceuticals and materials science, where its fluorinated structure may impart desirable characteristics such as increased lipophilicity or altered biological activity. Safety data should be consulted for handling and potential hazards associated with this chemical.

Formula: C₇H₅F₂NO₂

InChI: InChI=1S/C7H5F2NO2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,10H2,(H,11,12)

InChI key: InChIKey=NORJRQVQTYNLAO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N)C(F)=CC(F)=C1

Synonyms:

• 3,5-Difluoroanthranilic acid
• Benzoic Acid, 2-Amino-3,5-Difluoro-
• 2-Amino-3,5-difluorobenzoic acid

Benzoic acid, 2-amino-3,5-difluoro-

CAS: 126674-78-0

Formula: C₇H₅F₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.1169

Ref: IN-DA000T35

2-Amino-3,5-difluorobenzoic acid

CAS: 126674-78-0

2-Amino-3,5-difluorobenzoic acid

Formula: C₇H₅F₂NO₂

Purity: 98%

Color and Shape: yellow powder

Molecular weight: 173.12g/mol

Ref: 54-PC400736

2-Amino-3,5-difluorobenzoic acid

CAS: 126674-78-0

Formula: C₇H₅F₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 173.119

Ref: 10-F077712