CAS 126674-99-5
:1H-Pyrazole-5-carbonyl chloride, 3-methoxy-1-methyl-
Description:
1H-Pyrazole-5-carbonyl chloride, 3-methoxy-1-methyl- is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carbonyl chloride functional group, indicating the presence of a carbon atom double-bonded to an oxygen atom and single-bonded to a chlorine atom, which makes it a reactive acyl chloride. The methoxy group (–OCH3) and the methyl group (–CH3) attached to the pyrazole ring contribute to its overall reactivity and solubility properties. Typically, compounds like this are used in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals, due to their ability to participate in various chemical reactions, such as acylation and nucleophilic substitution. The presence of the carbonyl chloride group suggests that it can react with nucleophiles, making it a valuable intermediate in synthetic chemistry. Safety precautions should be observed when handling this compound, as carbonyl chlorides can be corrosive and harmful.
Formula:C6H7ClN2O2
InChI:InChI=1S/C6H7ClN2O2/c1-9-4(6(7)10)3-5(8-9)11-2/h3H,1-2H3
InChI key:InChIKey=JEFKCOVJMFYOGJ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1N(C)N=C(OC)C1
Synonyms:- 1H-Pyrazole-5-carbonyl chloride, 3-methoxy-1-methyl-
- 1-Methyl-3-methoxypyrazole-5-carbonyl chloride
- 3-Methoxy-1-methyl-1H-pyrazole-5-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
