CymitQuimica logo

CAS 126675-96-5

:

4-(2-Methoxyethenyl)benzonitrile

Description:
4-(2-Methoxyethenyl)benzonitrile, with the CAS number 126675-96-5, is an organic compound characterized by its aromatic structure and functional groups. It features a benzene ring substituted with a cyano group (nitrile) and a methoxyethenyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the nitrile group indicates that it may exhibit polar characteristics, influencing its solubility in various solvents. This compound is likely to participate in electrophilic aromatic substitution reactions due to the electron-donating nature of the methoxy group, which can enhance the reactivity of the aromatic ring. Additionally, the methoxyethenyl moiety may provide sites for further functionalization, making it a valuable intermediate in the synthesis of more complex organic molecules. Its unique structure suggests potential applications in materials science, pharmaceuticals, or as a building block in organic chemistry. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C10H9NO
InChI:InChI=1S/C10H9NO/c1-12-7-6-9-2-4-10(8-11)5-3-9/h2-7H,1H3
InChI key:InChIKey=ASUXXDULIDAXFE-UHFFFAOYSA-N
SMILES:C(=COC)C1=CC=C(C#N)C=C1
Synonyms:
  • Benzonitrile, 4-(2-methoxyethenyl)-
  • 4-(2-Methoxyethenyl)benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.