
CAS 126689-05-2
:Cyclopropanecarboxylic acid, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester, (1R,2R)-rel-
Description:
Cyclopropanecarboxylic acid, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester, (1R,2R)-rel- is a chemical compound characterized by its unique bicyclic structure and the presence of a cyclopropane ring. This compound features a carboxylic acid functional group, which contributes to its acidity and reactivity, and a methyl ester group that enhances its solubility in organic solvents. The presence of the dioxaborolane moiety indicates potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The (1R,2R)-rel- configuration suggests specific stereochemistry, which can influence the compound's reactivity and interaction with biological systems. Generally, compounds of this nature are of interest in medicinal chemistry and materials science due to their potential utility in drug development and as intermediates in synthetic pathways. Safety and handling precautions should be observed, as with all chemical substances, due to potential hazards associated with their reactivity and toxicity.
Formula:C11H19BO4
InChI:InChI=1/C11H19BO4/c1-10(2)11(3,4)16-12(15-10)8-6-7(8)9(13)14-5/h7-8H,6H2,1-5H3/t7-,8-/s2
InChI key:InChIKey=UZMWEJFFPHNEBB-YZYOREDDNA-N
SMILES:C(OC)(=O)[C@H]1[C@H](B2OC(C)(C)C(C)(C)O2)C1
Synonyms:- Cyclopropanecarboxylic acid, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester, trans-
- 1,3,2-Dioxaborolane, cyclopropanecarboxylic acid deriv.
- Cyclopropanecarboxylic acid, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester, (1R,2R)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cyclopropanecarboxylic acid, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester, (1R,2R)-rel-
CAS:Formula:C11H19BO4Molecular weight:226.0772
