CAS 126689-78-9
:Glycine, N-[3-(trifluoromethyl)phenyl]-, methyl ester
Description:
Glycine, N-[3-(trifluoromethyl)phenyl]-, methyl ester, with the CAS number 126689-78-9, is an organic compound that belongs to the class of amino acid derivatives. It features a glycine backbone, which is the simplest amino acid, modified by the addition of a trifluoromethylphenyl group at the nitrogen position and a methyl ester functional group. This structure imparts unique properties, including increased lipophilicity and potential biological activity. The trifluoromethyl group is known for enhancing the compound's metabolic stability and can influence its interaction with biological targets. Glycine derivatives are often studied for their roles in pharmaceuticals, particularly in the development of drugs that modulate neurotransmitter systems or exhibit anti-inflammatory properties. The compound may also exhibit interesting solubility characteristics due to the presence of both polar (the ester) and nonpolar (the trifluoromethyl group) functional groups. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and materials science.
Formula:C10H10F3NO2
InChI:InChI=1S/C10H10F3NO2/c1-16-9(15)6-14-8-4-2-3-7(5-8)10(11,12)13/h2-5,14H,6H2,1H3
InChI key:InChIKey=NXDJBFSBMWZWMC-UHFFFAOYSA-N
SMILES:N(CC(OC)=O)C1=CC(C(F)(F)F)=CC=C1
Synonyms:- Glycine, N-[3-(trifluoromethyl)phenyl]-, methyl ester
- NSC 71558
- N-(3-Trifluoromethylphenyl)glycine methyl ester
- (3-Trifluoromethyl-phenylamino)-acetic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.