CAS 126695-58-7: 4-Azido-2,3,5,6-tetrafluorobenzoicacid
Description:4-Azido-2,3,5,6-tetrafluorobenzoic acid is a fluorinated aromatic compound characterized by the presence of an azido group (-N3) and multiple fluorine atoms attached to a benzoic acid structure. The presence of four fluorine atoms significantly influences its chemical properties, including increased electronegativity and altered reactivity compared to non-fluorinated benzoic acids. The azido group introduces unique reactivity, making it a potential candidate for various applications in organic synthesis and materials science. This compound is typically used in research settings, particularly in the development of new materials or as an intermediate in the synthesis of more complex molecules. Its solubility and stability can vary depending on the solvent and conditions, and it may exhibit interesting photochemical properties due to the presence of the azido group. Safety precautions are essential when handling this compound, as azides can be sensitive and potentially explosive under certain conditions. Overall, 4-Azido-2,3,5,6-tetrafluorobenzoic acid is a valuable compound in the field of synthetic chemistry.
Formula:C11H4F4N4O4
InChI:InChI=1/C11H4F4N4O4/c12-6-5(7(13)9(15)10(8(6)14)17-18-16)11(22)23-19-3(20)1-2-4(19)21/h1-2H2
- Synonyms:
- Succinimidylester(ATFB,SE)
- 4-Azido-2,3,5,6-tetrafluorobenzoic Acid, N-Succinimidyl Ester, ATFB SE
- 1-{[(4-Azido-2,3,5,6-Tetrafluorophenyl)Carbonyl]Oxy}Pyrrolidine-2,5-Dione

N-Succinimidyl 4-Azido-2,3,5,6-tetrafluorobenzoate
Ref: 3B-S0952
1g | 478.00 € | ||
200mg | 142.00 € |

Benzoic acid, 4-azido-2,3,5,6-tetrafluoro-, 2,5-dioxo-1-pyrrolidinyl ester
Ref: IN-DA000T3G
Undefined size | To inquire |

4-N3Pfp-NHS ester
Ref: TM-T17337
100mg | To inquire | ||
500mg | To inquire |

ATFB-OSu
Ref: 54-BIBP1071
1g | 808.00 € | ||
100mg | 241.00 € | ||
250mg | 326.00 € |

Succinimidyl-4-azido-2,3,5,6-tetrafluorobenzoate
Ref: 10-F493878
1g | To inquire |

N-Succinimidyl 4-Azido-2,3,5,6-tetrafluorobenzoate
Controlled ProductRef: TR-S690150
50mg | 326.00 € | ||
100mg | 596.00 € | ||
500mg | 2,186.00 € |

N-Succinimidyl 4-azido-2,3,5,6-tetrafluorobenzoate
Ref: 3D-FS27896
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |