CAS 126695-58-7
:4-Azido-2,3,5,6-tetrafluorobenzoicacid
Description:
4-Azido-2,3,5,6-tetrafluorobenzoic acid is a fluorinated aromatic compound characterized by the presence of an azido group (-N3) and multiple fluorine atoms attached to a benzoic acid structure. The presence of four fluorine atoms significantly influences its chemical properties, including increased electronegativity and altered reactivity compared to non-fluorinated benzoic acids. The azido group introduces unique reactivity, making it a potential candidate for various applications in organic synthesis and materials science. This compound is typically used in research settings, particularly in the development of new materials or as an intermediate in the synthesis of more complex molecules. Its solubility and stability can vary depending on the solvent and conditions, and it may exhibit interesting photochemical properties due to the presence of the azido group. Safety precautions are essential when handling this compound, as azides can be sensitive and potentially explosive under certain conditions. Overall, 4-Azido-2,3,5,6-tetrafluorobenzoic acid is a valuable compound in the field of synthetic chemistry.
Formula:C11H4F4N4O4
InChI:InChI=1/C11H4F4N4O4/c12-6-5(7(13)9(15)10(8(6)14)17-18-16)11(22)23-19-3(20)1-2-4(19)21/h1-2H2
SMILES:C1CC(=O)N(C1=O)OC(=O)c1c(c(c(c(c1F)F)N=[N+]=[NH-])F)F
Synonyms:- Succinimidylester(ATFB,SE)
- 4-Azido-2,3,5,6-tetrafluorobenzoic Acid, N-Succinimidyl Ester, ATFB SE
- 1-{[(4-Azido-2,3,5,6-Tetrafluorophenyl)Carbonyl]Oxy}Pyrrolidine-2,5-Dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-Succinimidyl 4-Azido-2,3,5,6-tetrafluorobenzoate
CAS:Formula:C11H4F4N4O4Purity:>97.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:332.174-N3Pfp-NHS ester
CAS:4-N3Pfp-NHS ester is a noncleavable ADC linker utilized for synthesizing antibody-drug conjugates (ADCs).Formula:C11H4F4N4O4Purity:98%Color and Shape:SolidMolecular weight:332.17ATFB-OSu
CAS:<p>ATFB-OSu</p>Formula:C11H4F4N4O4Purity:>98%Color and Shape: off-whie powderMolecular weight:332.17g/molSuccinimidyl-4-azido-2,3,5,6-tetrafluorobenzoate
CAS:Formula:C11H4F4N4O4Purity:99.0%Molecular weight:332.171N-Succinimidyl 4-Azido-2,3,5,6-tetrafluorobenzoate
CAS:Controlled ProductFormula:C11H4F4N4O4Color and Shape:NeatMolecular weight:332.17Benzoic acid, 4-azido-2,3,5,6-tetrafluoro-, 2,5-dioxo-1-pyrrolidinyl ester
CAS:Formula:C11H4F4N4O4Color and Shape:SolidMolecular weight:332.1675





