
CAS 126695-59-8
:4-Azido-2,3,5,6-tetrafluorobenzenemethanol
Description:
4-Azido-2,3,5,6-tetrafluorobenzenemethanol is an organic compound characterized by the presence of an azido group (-N3) and multiple fluorine substituents on a benzene ring. The molecular structure features a tetrafluorobenzene moiety, which significantly influences its chemical reactivity and physical properties. The presence of the hydroxymethyl group (-CH2OH) adds to its functionality, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically used in research and development, particularly in the fields of materials science and medicinal chemistry, due to its unique electronic properties and reactivity. Its fluorinated nature may impart increased stability and lipophilicity, while the azido group can facilitate further transformations, such as click chemistry. Safety considerations are essential when handling this compound, as azides can be sensitive and potentially explosive under certain conditions. Overall, 4-Azido-2,3,5,6-tetrafluorobenzenemethanol is a versatile compound with significant implications in synthetic chemistry.
Formula:C7H3F4N3O
InChI:InChI=1S/C7H3F4N3O/c8-3-2(1-15)4(9)6(11)7(5(3)10)13-14-12/h15H,1H2
InChI key:InChIKey=PQCRBYQLJBCLEN-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C1=C(F)C(F)=C(CO)C(F)=C1F
Synonyms:- (4-Azido-2,3,5,6-tetrafluorophenyl)methanol
- Benzenemethanol, 4-azido-2,3,5,6-tetrafluoro-
- 4-Azido-2,3,5,6-tetrafluorobenzenemethanol
- 2,3,5,6-Tetrafluoro-4-azidobenzyl alcohol
- 4-Azido-2,3,5,6-tetrafluorobenzyl alcohol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.