CAS 126716-34-5

Gancaonin G

Description:

Gancaonin G is a chemical compound classified as a flavonoid, which is a type of polyphenolic compound commonly found in various plants. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. The structure of Gancaonin G features multiple hydroxyl groups, contributing to its reactivity and interaction with biological systems. This compound has garnered interest in pharmacological research due to its potential therapeutic effects, particularly in the context of chronic diseases and conditions associated with oxidative stress. Additionally, Gancaonin G may exhibit effects on cellular signaling pathways, which could influence processes such as cell proliferation and apoptosis. Its natural occurrence in certain plant species suggests a role in plant defense mechanisms, and ongoing studies aim to elucidate its full range of biological activities and potential applications in medicine and health. As with many flavonoids, the bioavailability and metabolism of Gancaonin G in humans are important factors that influence its efficacy and therapeutic potential.

Formula: C₂₁H₂₀O₅

InChI: InChI=1S/C21H20O5/c1-12(2)4-9-15-17(25-3)10-18-19(20(15)23)21(24)16(11-26-18)13-5-7-14(22)8-6-13/h4-8,10-11,22-23H,9H2,1-3H3

InChI key: InChIKey=WLPHLDLTTPUDSI-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(OC)=C(CC=C(C)C)C2O)OC=C1C3=CC=C(O)C=C3

Synonyms:

• 4H-1-Benzopyran-4-one, 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-6-(3-methyl-2-buten-1-yl)-
• 4H-1-Benzopyran-4-one, 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-6-(3-methyl-2-butenyl)-
• 5-Hydroxy-3-(4-hydroxy-phenyl)-7-methoxy-6-(3-methyl-but-2-enyl)-1-benzopyran-4-one
• 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-6-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
• Gancaonin G

4H-1-Benzopyran-4-one, 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-6-(3-methyl-2-buten-1-yl)-

CAS: 126716-34-5

Formula: C₂₁H₂₀O₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 352.3805

Ref: IN-DA000T59

Gancaonin G

CAS: 126716-34-5

Gancaonin G has antibacterial properties: MIC of 16 µg/ml against MRSA, less effective on Streptococcus mutans.

Formula: C₂₁H₂₀O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 352.38

Ref: TM-TN4097

Gancaonin G

CAS: 126716-34-5

Formula: C₂₁H₂₀O₅

Purity: 95%~99%

Molecular weight: 352.386

Ref: BP-SBP03378

Gancaonin G

CAS: 126716-34-5

Gancaonin G is a flavonoid compound, which is a type of bioactive molecule derived from the root of Glycyrrhiza species, commonly known as licorice. It is characterized by its unique molecular structure that contributes to its biological activities. The mode of action of Gancaonin G involves the modulation of inflammatory pathways. It inhibits specific enzymes and signaling molecules involved in the inflammatory response, thereby reducing inflammation and associated oxidative stress.

Formula: C₂₁H₂₀O₅

Purity: Min. 95%

Molecular weight: 352.4 g/mol

Ref: 3D-BFA71634