CymitQuimica logo

CAS 1267224-21-4

:

6-bromo-2-cyclopropyl-5-methylbenzo[d]oxazole

Description:
6-Bromo-2-cyclopropyl-5-methylbenzo[d]oxazole is a chemical compound characterized by its unique structural features, which include a bromine atom, a cyclopropyl group, and a methyl group attached to a benzo[d]oxazole ring system. This compound belongs to the class of heterocyclic compounds, specifically oxazoles, which are known for their aromatic properties and potential biological activity. The presence of the bromine atom can influence the compound's reactivity and solubility, while the cyclopropyl group may impart strain and unique steric effects. The methyl group contributes to the overall hydrophobic character of the molecule. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their diverse chemical reactivity and ability to interact with biological systems. The specific properties, such as melting point, boiling point, and solubility, would require experimental determination or literature reference for precise values. Overall, 6-bromo-2-cyclopropyl-5-methylbenzo[d]oxazole represents a fascinating area of study within organic chemistry.
Formula:C11H10BrNO
InChI:InChI=1S/C11H10BrNO/c1-6-4-9-10(5-8(6)12)14-11(13-9)7-2-3-7/h4-5,7H,2-3H2,1H3
InChI key:KREGOYMGZLDVSQ-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1Br)OC(=N2)C3CC3
Synonyms:
  • 6-bromo-2-cyclopropyl-5-methylbenzo[d]oxazole
  • Benzoxazole, 6-bromo-2-cyclopropyl-5-methyl-
Found 3 products.