CymitQuimica logo

CAS 126726-63-4

:

rel-2-[(1R,2R)-2-(3-Chloropropyl)cyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
Rel-2-[(1R,2R)-2-(3-Chloropropyl)cyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane structure, which features a five-membered ring containing boron and oxygen atoms. The compound includes a cyclopropyl group, which contributes to its three-dimensional conformation and may influence its reactivity and interactions with other molecules. The presence of a chloropropyl substituent enhances its potential for various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. Its tetramethyl substituents provide steric hindrance, which can affect the compound's stability and solubility in different solvents. Additionally, the specific stereochemistry indicated by the (1R,2R) configuration suggests that the compound may exhibit chiral properties, potentially leading to enantioselective behavior in reactions. Overall, this compound's structural features make it a valuable candidate for applications in medicinal chemistry and materials science.
Formula:C12H22BClO2
InChI:InChI=1/C12H22BClO2/c1-11(2)12(3,4)16-13(15-11)10-8-9(10)6-5-7-14/h9-10H,5-8H2,1-4H3/t9-,10-/s2
InChI key:InChIKey=WEPJLNOQGOQHBW-WSYQHHSTNA-N
SMILES:C(CCCl)[C@H]1[C@H](B2OC(C)(C)C(C)(C)O2)C1
Synonyms:
  • 1,3,2-Dioxaborolane, 2-[(1R,2R)-2-(3-chloropropyl)cyclopropyl]-4,4,5,5-tetramethyl-, rel-
  • 1,3,2-Dioxaborolane, 2-[2-(3-chloropropyl)cyclopropyl]-4,4,5,5-tetramethyl-, trans-
  • rel-2-[(1R,2R)-2-(3-Chloropropyl)cyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.