CAS 126728-20-9
:2,4-Dichloropyrido[2,3-d]pyrimidine
Description:
2,4-Dichloropyrido[2,3-d]pyrimidine is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which incorporate two chlorine substituents at the 2 and 4 positions. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of chlorine atoms enhances its reactivity and may influence its biological activity. 2,4-Dichloropyrido[2,3-d]pyrimidine is generally soluble in organic solvents, but its solubility in water is limited. The compound's structure contributes to its unique electronic properties, making it a subject of interest in various chemical research fields. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper safety protocols should be followed when working with this substance in laboratory settings.
Formula:C7H3Cl2N3
InChI:InChI=1/C7H3Cl2N3/c8-5-4-2-1-3-10-6(4)12-7(9)11-5/h1-3H
SMILES:c1cc2c(Cl)nc(Cl)nc2nc1
Synonyms:- Pyrido[2,3-d]pyrimidine, 2,4-dichloro-
- 2,4-Dichloro-pyrido[2,3-d]pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyrido[2,3-d]pyrimidine, 2,4-dichloro-
CAS:Formula:C7H3Cl2N3Purity:97%Color and Shape:SolidMolecular weight:200.02482,4-Dichloropyrido[2,3-d]pyrimidine
CAS:2,4-Dichloropyrido[2,3-d]pyrimidine
Molecular weight:200.02482g/mol2,4-Dichloropyrido[2,3-d]pyrimidine
CAS:Formula:C7H3Cl2N3Purity:98%Color and Shape:SolidMolecular weight:200.022,4-Dichloropyrido [2,3-D] pyrimidine
CAS:2,4-Dichloropyrido [2,3-D] pyrimidine is a regioselective chlorination agent that can be used for the synthesis of various organic compounds. It is often used in cross-coupling reactions to form carbon-carbon bonds. 2,4-Dichloropyrido [2,3-D] pyrimidine has been shown to give high yields and is selective for disubstituted or monosubstituted substrates. This compound is also useful for the functionalization of C-H bonds via palladium-catalyzed coupling reactions.
Formula:C7H3Cl2N3Purity:Min. 95%Color and Shape:White PowderMolecular weight:200.02 g/mol




