CymitQuimica logo

CAS 126766-56-1

:

Methyl 3-(hydroxymethyl)-1-piperazinecarboxylate

Description:
Methyl 3-(hydroxymethyl)-1-piperazinecarboxylate, identified by its CAS number 126766-56-1, is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features a hydroxymethyl group and a carboxylate ester functional group, contributing to its potential reactivity and solubility in various solvents. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the hydroxymethyl group enhances its ability to participate in hydrogen bonding, which can influence its physical properties such as boiling point and solubility. Methyl 3-(hydroxymethyl)-1-piperazinecarboxylate may be utilized in pharmaceutical applications, particularly in the synthesis of biologically active compounds, due to its structural similarity to various neurotransmitters and its potential to interact with biological systems. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H14N2O3
InChI:InChI=1S/C7H14N2O3/c1-12-7(11)9-3-2-8-6(4-9)5-10/h6,8,10H,2-5H2,1H3
InChI key:InChIKey=URRJXZRIRRSAAC-UHFFFAOYSA-N
SMILES:C(OC)(=O)N1CC(CO)NCC1
Synonyms:
  • Methyl 3-(hydroxymethyl)-1-piperazinecarboxylate
  • 1-Piperazinecarboxylic acid, 3-(hydroxymethyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.