
CAS 126766-61-8
:1-Piperazinecarboxylic acid, 3-(hydroxymethyl)-, methyl ester, (S)-
Description:
1-Piperazinecarboxylic acid, 3-(hydroxymethyl)-, methyl ester, (S)-, with CAS number 126766-61-8, is a chemical compound characterized by its piperazine ring structure, which contributes to its biological activity and potential pharmacological applications. This compound features a carboxylic acid functional group and a hydroxymethyl substituent, which enhance its solubility and reactivity. The methyl ester group indicates that it can undergo hydrolysis to release the corresponding acid, making it useful in various chemical reactions. The (S)- designation signifies that it has a specific stereochemistry, which can influence its interaction with biological targets, potentially affecting its efficacy and safety profile. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological systems. Its properties, such as solubility, stability, and reactivity, are influenced by the presence of functional groups and the stereochemistry of the molecule.
Formula:C7H14N2O3
InChI:InChI=1S/C7H14N2O3/c1-12-7(11)9-3-2-8-6(4-9)5-10/h6,8,10H,2-5H2,1H3/t6-/m0/s1
InChI key:InChIKey=URRJXZRIRRSAAC-LURJTMIESA-N
SMILES:C(OC)(=O)N1C[C@@H](CO)NCC1
Synonyms:- 1-Piperazinecarboxylic acid, 3-(hydroxymethyl)-, methyl ester, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Piperazinecarboxylic acid, 3-(hydroxymethyl)-, methyl ester, (S)- (9CI)
CAS:Formula:C7H14N2O3Molecular weight:174.1977
