CAS 126768-40-9
:5-METHYL-2-THIOPHENECARBOXYLIC ACID HYDRAZIDE
Description:
5-Methyl-2-thiophenecarboxylic acid hydrazide is an organic compound characterized by its hydrazide functional group attached to a thiophene ring. This compound typically exhibits properties associated with both thiophene derivatives and hydrazides, such as potential biological activity and reactivity due to the presence of the hydrazide moiety. It may be soluble in polar organic solvents, and its melting point and boiling point can vary based on purity and specific structural features. The presence of the methyl group on the thiophene ring can influence its electronic properties and steric hindrance, potentially affecting its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry and materials science due to its unique structural characteristics, which could lead to applications in drug development or as a building block in organic synthesis. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C6H8N2OS
InChI:InChI=1/C6H8N2OS/c1-4-2-3-5(10-4)6(9)8-7/h2-3H,7H2,1H3,(H,8,9)
SMILES:Cc1ccc(C(=O)NN)s1
Synonyms:- 5-Methyl-Thiophene-2-Carboxylic Acid Hydrazide
- 2-Thiophenecarboxylicacid5-methylhydrazide
- 2-Thiophenecarboxylicacid,5-methyl-,hydrazide(9CI)
- 5-Methylthiophene-2-Carbohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
5-Methyl-2-thiophenecarboxylic acid hydrazide
CAS:5-Methyl-2-thiophenecarboxylic acid hydrazide
Molecular weight:156.20552g/mol5-Methyl-thiophene-2-carboxylic acid hydrazide
CAS:Formula:C6H8N2OSColor and Shape:SolidMolecular weight:156.2



