CymitQuimica logo

CAS 126771-41-3

:

4-(Bromomethyl)phenoxyacetic acid

Description:
4-(Bromomethyl)phenoxyacetic acid is an organic compound characterized by its phenoxyacetic acid structure, which includes a bromomethyl group attached to the phenyl ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic phenyl group. The presence of the bromomethyl group enhances its reactivity, making it useful in various chemical syntheses and applications, particularly in the field of agrochemicals and pharmaceuticals. The compound exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in acid-base reactions. Its molecular structure contributes to its potential as a herbicide or plant growth regulator, as it can interact with biological systems. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate risks associated with its use.
Formula:C9H9BrO3
InChI:InChI=1/C9H9BrO3/c10-5-7-1-3-8(4-2-7)13-6-9(11)12/h1-4H,5-6H2,(H,11,12)
SMILES:c1cc(ccc1CBr)OCC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.