CymitQuimica logo

CAS 126773-84-0

:

5-Bromo-2-(4-chlorophenyl)oxazole

Description:
5-Bromo-2-(4-chlorophenyl)oxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a bromine atom at the 5-position and a para-chlorophenyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the halogen substituents, which can influence its solubility in organic solvents. It may also display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. The molecular structure allows for potential interactions with biological targets, and its halogen substituents can enhance its reactivity in various chemical reactions. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and chlorine atoms, which can affect its behavior in synthetic applications and biological systems. Overall, 5-Bromo-2-(4-chlorophenyl)oxazole is a compound of interest for further research in both synthetic and applied chemistry contexts.
Formula:C9H5BrClNO
InChI:InChI=1S/C9H5BrClNO/c10-8-5-12-9(13-8)6-1-3-7(11)4-2-6/h1-5H
InChI key:InChIKey=BZZJLDMKEHQILN-UHFFFAOYSA-N
SMILES:BrC=1OC(C2=CC=C(Cl)C=C2)=NC1
Synonyms:
  • Oxazole, 5-bromo-2-(4-chlorophenyl)-
  • 5-Bromo-2-(4-chlorophenyl)oxazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.