CAS 1267865-81-5

2-(4-Fluoro-3-methylphenyl)cyclopropanamine

Description:

2-(4-Fluoro-3-methylphenyl)cyclopropanamine is a chemical compound characterized by its cyclopropane structure fused with an amine group and a substituted aromatic ring. The presence of a fluorine atom and a methyl group on the phenyl ring contributes to its unique electronic and steric properties, which can influence its reactivity and biological activity. This compound is likely to exhibit moderate polarity due to the amine functional group, which can engage in hydrogen bonding. The cyclopropane moiety introduces ring strain, potentially affecting the compound's stability and reactivity. Additionally, the specific substitution pattern on the aromatic ring may impart distinct pharmacological properties, making it of interest in medicinal chemistry. The compound's CAS number, 1267865-81-5, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, 2-(4-Fluoro-3-methylphenyl)cyclopropanamine represents a class of compounds that may have potential applications in drug development and other chemical research fields.

Formula: C₁₀H₁₂FN

InChI: InChI=1S/C10H12FN/c1-6-4-7(2-3-9(6)11)8-5-10(8)12/h2-4,8,10H,5,12H2,1H3

InChI key: InChIKey=UNHLXGCEFDBPGQ-UHFFFAOYSA-N

SMILES: NC1C(C1)C2=CC(C)=C(F)C=C2

Synonyms:

• 2-(4-Fluoro-3-methylphenyl)cyclopropanamine
• Cyclopropanamine, 2-(4-fluoro-3-methylphenyl)-