CAS 126799-82-4
:Methylbenzylazide; 98%
Description:
Methylbenzylazide, with the CAS number 126799-82-4, is an organic compound characterized by its azide functional group, which is known for its reactivity and potential applications in organic synthesis and materials science. This compound typically appears as a colorless to pale yellow liquid and has a distinctive aromatic odor due to the presence of the benzyl group. Methylbenzylazide is soluble in organic solvents, making it useful in various chemical reactions, particularly in the synthesis of more complex molecules. It is important to handle this substance with care, as azides can be sensitive to heat, shock, and friction, leading to potential explosive decomposition. Additionally, safety precautions should be taken to avoid exposure, as azides can be toxic and pose health risks. Overall, methylbenzylazide serves as a valuable intermediate in the synthesis of pharmaceuticals and other chemical products, highlighting its significance in the field of organic chemistry.
Formula:C8H9N3
InChI:InChI=1/C8H9N3/c1-7-3-2-4-8(5-7)6-10-11-9/h2-5H,6H2,1H3
SMILES:Cc1cccc(c1)CN=[N+]=[NH-]
Synonyms:- 3-Methyl-benzylazide
- 1-(Azidomethyl)-3-Methylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-(Azidomethyl)-3-methylbenzene
CAS:<p>1-(Azidomethyl)-3-methylbenzene is a cavity-forming molecule that can be used as a supramolecular host. It has been shown to interact with bioactive molecules and inorganic materials, such as metal cations. It has also been observed to have anti-inflammatory effects due to its ability to inhibit the production of prostaglandins. The crystal structure of 1-(azidomethyl)-3-methylbenzene was validated by approximations and simulations, which revealed that the molecule has two cavities. Crystals of 1-(azidomethyl)-3-methylbenzene are small enough for x-ray crystallography and desulfurization techniques.</p>Formula:C8H9N3Purity:Min. 95%Molecular weight:147.18 g/mol

