
CAS 126799-84-6
:1-(Azidomethyl)-3-nitrobenzene
Description:
1-(Azidomethyl)-3-nitrobenzene is an organic compound characterized by the presence of both azide and nitro functional groups attached to a benzene ring. The azidomethyl group (-CH2N3) is a reactive moiety that can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry. The nitro group (-NO2) is known for its electron-withdrawing properties, which can influence the reactivity of the aromatic system. This compound typically appears as a solid at room temperature and may exhibit moderate to high stability under standard conditions, although it can be sensitive to heat and shock due to the presence of the azide group. Its applications may include use in the synthesis of more complex molecules, particularly in the fields of materials science and medicinal chemistry. Safety precautions are essential when handling this compound, as azides can be hazardous and potentially explosive under certain conditions. Proper storage and handling protocols should be followed to mitigate risks associated with its reactivity.
Formula:C7H6N4O2
InChI:InChI=1S/C7H6N4O2/c8-10-9-5-6-2-1-3-7(4-6)11(12)13/h1-4H,5H2
InChI key:InChIKey=ZSACFMUAFYJZDW-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])C1=CC(N(=O)=O)=CC=C1
Synonyms:- m-Nitrobenzyl azide
- 1-(Azidomethyl)-3-nitrobenzene
- 3-Nitrobenzyl azide
- Benzene, 1-(azidomethyl)-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.