CAS 126807-08-7
:3-BROMO-4-NITROINDOLE
Description:
3-Bromo-4-nitroindole is an organic compound characterized by the presence of both bromine and nitro functional groups attached to an indole structure. The indole moiety consists of a fused benzene and pyrrole ring, which contributes to the compound's aromaticity and potential biological activity. The bromine atom, located at the 3-position, introduces a halogen that can influence the compound's reactivity and lipophilicity, while the nitro group at the 4-position can serve as an electron-withdrawing group, affecting the electronic properties of the indole ring. This compound is typically used in organic synthesis and may have applications in medicinal chemistry due to its structural features that can interact with biological targets. Its properties, such as solubility, melting point, and stability, can vary based on the specific conditions and solvents used. As with many nitro-substituted compounds, 3-bromo-4-nitroindole may exhibit interesting pharmacological activities, making it a subject of interest in research and development.
Formula:C8H5BrN2O2
InChI:InChI=1/C8H5BrN2O2/c9-5-4-10-6-2-1-3-7(8(5)6)11(12)13/h1-4,10H
SMILES:c1cc2c(c(c[nH]2)Br)c(c1)N(=O)=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-4-nitroindole, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H5BrN2O2Purity:97%Molecular weight:241.041H-Indole, 3-bromo-4-nitro-
CAS:Formula:C8H5BrN2O2Purity:95%Color and Shape:SolidMolecular weight:241.0415



