CymitQuimica logo

CAS 126807-20-3

:

2-Amino-α-oxo-3-pyridineacetic acid

Description:
2-Amino-α-oxo-3-pyridineacetic acid, with the CAS number 126807-20-3, is an organic compound characterized by its pyridine ring structure, which contributes to its unique chemical properties. This compound features an amino group, a keto group, and a carboxylic acid functionality, making it a versatile molecule in various chemical reactions. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid and amino groups. The compound may exhibit biological activity, potentially serving as a building block in pharmaceuticals or agrochemicals. Its structure allows for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Additionally, the presence of the pyridine ring may impart specific electronic properties, affecting its behavior in chemical reactions and biological systems. Overall, 2-Amino-α-oxo-3-pyridineacetic acid is a compound of interest in both synthetic chemistry and medicinal applications.
Formula:C7H6N2O3
InChI:InChI=1S/C7H6N2O3/c8-6-4(2-1-3-9-6)5(10)7(11)12/h1-3H,(H2,8,9)(H,11,12)
InChI key:InChIKey=KTNWXTGCPDOTIS-UHFFFAOYSA-N
SMILES:C(C(O)=O)(=O)C1=C(N)N=CC=C1
Synonyms:
  • 2-Amino-α-oxo-3-pyridineacetic acid
  • 2-(2-Aminopyridin-3-yl)-2-oxoacetic acid
  • 3-Pyridineacetic acid, 2-amino-α-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.