
CAS 126815-81-4
:L-Tyrosine, 3-amino-, polymer with 5-amino-2,3-dihydro-1,4-phthalazinedione
Description:
L-Tyrosine, 3-amino-, polymer with 5-amino-2,3-dihydro-1,4-phthalazinedione, identified by CAS number 126815-81-4, is a synthetic polymer that incorporates the amino acid L-Tyrosine and a phthalazinedione derivative. This compound exhibits characteristics typical of polymers, such as increased molecular weight and enhanced mechanical properties compared to its monomeric constituents. The presence of L-Tyrosine contributes to its potential bioactivity, as this amino acid is a precursor for neurotransmitters and plays a role in protein synthesis. The phthalazinedione component may impart specific chemical reactivity and stability, making the polymer suitable for various applications, including drug delivery systems and biomaterials. Additionally, the polymer's structure may allow for interactions with biological systems, potentially influencing its solubility, biocompatibility, and degradation rates. Overall, this compound represents a unique combination of organic chemistry and biochemistry, with potential implications in pharmaceuticals and materials science.
Formula:(C9H12N2O3·C8H7N3O2)x
InChI:InChI=1S/C9H12N2O3.C8H7N3O2/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14;9-5-3-1-2-4-6(5)8(13)11-10-7(4)12/h1-3,7,12H,4,10-11H2,(H,13,14);1-3H,9H2,(H,10,12)(H,11,13)/t7-;/m0./s1
InChI key:InChIKey=FKDLDISFZUNJQD-FJXQXJEOSA-N
SMILES:O=C1C=2C(C(=O)NN1)=C(N)C=CC2.C([C@@H](C(O)=O)N)C1=CC(N)=C(O)C=C1
Synonyms:- 3-Amino-L-tyrosine-luminol copolymer
- L-Tyrosine, 3-amino-, polymer with 5-amino-2,3-dihydro-1,4-phthalazinedione
- 1,4-Phthalazinedione, 5-amino-2,3-dihydro-, polymer with 3-amino-L-tyrosine
- Diazoluminomelanin
- DALM
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
L-Tyrosine, 3-amino-, polymer with 5-amino-2,3-dihydro-1,4-phthalazinedione
CAS:Formula:C17H19N5O5Molecular weight:373.3633Diazoluminolmelanin
CAS:Diazoluminolmelanin is a synthetic luminescent biopolymer.Formula:C17H19N5O5Color and Shape:SolidMolecular weight:373.36

