
CAS 1268154-08-0
:7-Fluoro-5-benzoxazolamine
Description:
7-Fluoro-5-benzoxazolamine is a chemical compound characterized by the presence of a benzoxazole ring, which is a bicyclic structure containing both benzene and oxazole moieties. The "7-fluoro" designation indicates that a fluorine atom is substituted at the seventh position of the benzoxazole ring, while the "5-amino" part refers to an amino group (-NH2) attached at the fifth position. This compound is typically classified as an aromatic heterocycle due to the inclusion of nitrogen and oxygen in its structure. It may exhibit properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the fluorine atom can influence the compound's electronic properties, stability, and reactivity, potentially enhancing its pharmacological profile. As with many heterocyclic compounds, its synthesis and characterization would involve various analytical techniques to confirm its structure and purity.
Formula:C7H5FN2O
InChI:InChI=1S/C7H5FN2O/c8-5-1-4(9)2-6-7(5)11-3-10-6/h1-3H,9H2
InChI key:InChIKey=BFSXQMXASCSKHG-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(N)=C1)N=CO2
Synonyms:- 5-Benzoxazolamine, 7-fluoro-
- 7-Fluoro-5-benzoxazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.