
CAS 1268245-54-0
:3,5-Dichloro-4-[4-(chloromethyl)-5-cyclopropyl-3-isoxazolyl]pyridine
Description:
3,5-Dichloro-4-[4-(chloromethyl)-5-cyclopropyl-3-isoxazolyl]pyridine is a synthetic organic compound characterized by its complex structure, which includes a pyridine ring substituted with dichloro and isoxazole groups. The presence of chlorine atoms enhances its reactivity and potential biological activity, while the cyclopropyl group may influence its conformational properties and interactions with biological targets. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic and cyclic structures, which can affect its solubility and permeability in biological systems. Its isoxazole moiety may contribute to its pharmacological properties, making it of interest in medicinal chemistry. The compound's unique combination of functional groups suggests potential applications in drug development, particularly in targeting specific receptors or enzymes. However, detailed studies on its toxicity, stability, and specific biological activities would be necessary to fully understand its potential uses and safety profile.
Formula:C12H9Cl3N2O
InChI:InChI=1S/C12H9Cl3N2O/c13-3-7-11(17-18-12(7)6-1-2-6)10-8(14)4-16-5-9(10)15/h4-6H,1-3H2
InChI key:InChIKey=MVZWNBAQYGMVOM-UHFFFAOYSA-N
SMILES:C(Cl)C=1C(=NOC1C2CC2)C=3C(Cl)=CN=CC3Cl
Synonyms:- 3,5-Dichloro-4-[4-(chloromethyl)-5-cyclopropyl-3-isoxazolyl]pyridine
- Pyridine, 3,5-dichloro-4-[4-(chloromethyl)-5-cyclopropyl-3-isoxazolyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.