CymitQuimica logo

CAS 126826-47-9

:

4-amino-N-[(2Z)-1-methylpyrrolidin-2-ylidene]benzenesulfonamide

Description:
4-amino-N-[(2Z)-1-methylpyrrolidin-2-ylidene]benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The structure features an amino group (-NH2) attached to a benzene ring, which is further substituted with a sulfonamide group (-SO2NH2). The compound also contains a pyrrolidine moiety, specifically a 1-methylpyrrolidin-2-ylidene group, indicating a cyclic structure with a nitrogen atom in the ring. This configuration suggests potential biological activity, possibly as an inhibitor or modulator in various biochemical pathways. The presence of both the sulfonamide and the pyrrolidine components may contribute to its solubility and reactivity, making it of interest in medicinal chemistry. Additionally, the compound's stereochemistry, indicated by the (2Z) notation, suggests specific spatial arrangements that could influence its interaction with biological targets. Overall, this compound's unique structural features position it as a candidate for further research in pharmacology and related fields.
Formula:C11H15N3O2S
InChI:InChI=1/C11H15N3O2S/c1-14-8-2-3-11(14)13-17(15,16)10-6-4-9(12)5-7-10/h4-7H,2-3,8,12H2,1H3/b13-11-
SMILES:CN1CCC/C/1=N/S(=O)(=O)c1ccc(cc1)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.